C20H14F9NO3 — CID 87540724
[3,5-bis(trifluoromethyl)phenyl]methyl-[1-[2-formyl-5-(trifluoromethyl)phenyl]ethyl]carbamic acid (PubChem CID 87540724) has the molecular formula C20H14F9NO3 and a molecular weight of 487.32 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methyl-[1-[2-formyl-5-(trifluoromethyl)phenyl]ethyl]carbamic acid.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methyl-[1-[2-formyl-5-(trifluoromethyl)phenyl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 87540724 |
| Molecular Formula | C20H14F9NO3 |
| Molecular Weight | 487.32 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methyl-[1-[2-formyl-5-(trifluoromethyl)phenyl]ethyl]carbamic acid |
| SMILES | CC(c1cc(C(F)(F)F)ccc1C=O)N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C20H14F9NO3/c1-10(16-7-13(18(21,22)23)3-2-12(16)9-31)30(17(32)33)8-11-4-14(19(24,25)26)6-15(5-11)20(27,28)29/h2-7,9-10H,8H2,1H3,(H,32,33) |
| InChIKey | HCHWBGUOVQIRRS-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.32 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|