C25H30F6N2O3 — CID 87786993
[3,5-bis(trifluoromethyl)phenyl]methyl-[1-[2-(dipropylamino)-5-methoxyphenyl]ethyl]carbamic acid (PubChem CID 87786993) has the molecular formula C25H30F6N2O3 and a molecular weight of 520.51 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methyl-[1-[2-(dipropylamino)-5-methoxyphenyl]ethyl]carbamic acid.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methyl-[1-[2-(dipropylamino)-5-methoxyphenyl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 87786993 |
| Molecular Formula | C25H30F6N2O3 |
| Molecular Weight | 520.51 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methyl-[1-[2-(dipropylamino)-5-methoxyphenyl]ethyl]carbamic acid |
| SMILES | CCCN(CCC)c1ccc(OC)cc1C(C)N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C25H30F6N2O3/c1-5-9-32(10-6-2)22-8-7-20(36-4)14-21(22)16(3)33(23(34)35)15-17-11-18(24(26,27)28)13-19(12-17)25(29,30)31/h7-8,11-14,16H,5-6,9-10,15H2,1-4H3,(H,34,35) |
| InChIKey | ZINSYONTNUXCOI-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.51 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|