C25H27F9N2O3 — CID 152565496
[1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-(dipropylamino)-5-(trifluoromethoxy)phenyl]propan-2-yl] carbamate (PubChem CID 152565496) has the molecular formula C25H27F9N2O3 and a molecular weight of 574.48 g/mol. Its IUPAC name is [1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-(dipropylamino)-5-(trifluoromethoxy)phenyl]propan-2-yl] carbamate.
| Compound Name | [1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-(dipropylamino)-5-(trifluoromethoxy)phenyl]propan-2-yl] carbamate |
|---|---|
| PubChem CID | 152565496 |
| Molecular Formula | C25H27F9N2O3 |
| Molecular Weight | 574.48 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | [1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-(dipropylamino)-5-(trifluoromethoxy)phenyl]propan-2-yl] carbamate |
| SMILES | CCCN(CCC)c1ccc(OC(F)(F)F)cc1CC(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)OC(N)=O |
| InChI | InChI=1S/C25H27F9N2O3/c1-3-7-36(8-4-2)21-6-5-19(39-25(32,33)34)12-16(21)13-20(38-22(35)37)11-15-9-17(23(26,27)28)14-18(10-15)24(29,30)31/h5-6,9-10,12,14,20H,3-4,7-8,11,13H2,1-2H3,(H2,35,37) |
| InChIKey | YQJWJBMLZPZLMQ-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.48 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|