About 1-(4,5-dimethylthiophen-2-yl)-2-methylpropan-1-one
1-(4,5-dimethylthiophen-2-yl)-2-methylpropan-1-one (PubChem CID 114962093) has the molecular formula C10H14OS
and a molecular weight of 182.29 g/mol. Its IUPAC name is 1-(4,5-dimethylthiophen-2-yl)-2-methylpropan-1-one.
Analyze 1-(4,5-dimethylthiophen-2-yl)-2-methylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dimethylthiophen-2-yl)-2-methylpropan-1-one?
The IUPAC name of 1-(4,5-dimethylthiophen-2-yl)-2-methylpropan-1-one (CID 114962093) is 1-(4,5-dimethylthiophen-2-yl)-2-methylpropan-1-one.
What is the SMILES notation for 1-(4,5-dimethylthiophen-2-yl)-2-methylpropan-1-one?
The canonical SMILES for 1-(4,5-dimethylthiophen-2-yl)-2-methylpropan-1-one is Cc1cc(C(=O)C(C)C)sc1C.
What is the InChIKey of 1-(4,5-dimethylthiophen-2-yl)-2-methylpropan-1-one?
The InChIKey is UQSZAQWSKCWULR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14OS/c1-6(2)10(11)9-5-7(3)8(4)12-9/h5-6H,1-4H3.
What are the key properties of 1-(4,5-dimethylthiophen-2-yl)-2-methylpropan-1-one?
1-(4,5-dimethylthiophen-2-yl)-2-methylpropan-1-one has a molecular weight of 182.29 g/mol, XLogP of 3.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dimethylthiophen-2-yl)-2-methylpropan-1-one is sourced from PubChem (CID 114962093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).