C10H12Br3NOS — CID 107966256
2,5-dibromo-N-(3-bromopropyl)-N-ethylthiophene-3-carboxamide (PubChem CID 107966256) has the molecular formula C10H12Br3NOS and a molecular weight of 433.99 g/mol. Its IUPAC name is 2,5-dibromo-N-(3-bromopropyl)-N-ethylthiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-(3-bromopropyl)-N-ethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 107966256 |
| Molecular Formula | C10H12Br3NOS |
| Molecular Weight | 433.99 g/mol |
| Exact Mass | 430.82 |
| IUPAC Name | 2,5-dibromo-N-(3-bromopropyl)-N-ethylthiophene-3-carboxamide |
| SMILES | CCN(CCCBr)C(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C10H12Br3NOS/c1-2-14(5-3-4-11)10(15)7-6-8(12)16-9(7)13/h6H,2-5H2,1H3 |
| InChIKey | PGWJZZLICUBSSJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.99 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|