C13H10ClF4NOS — CID 107491958
N-(2-chloroethyl)-6-fluoro-N-(2,2,2-trifluoroethyl)-1-benzothiophene-2-carboxamide (PubChem CID 107491958) has the molecular formula C13H10ClF4NOS and a molecular weight of 339.74 g/mol. Its IUPAC name is N-(2-chloroethyl)-6-fluoro-N-(2,2,2-trifluoroethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-chloroethyl)-6-fluoro-N-(2,2,2-trifluoroethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 107491958 |
| Molecular Formula | C13H10ClF4NOS |
| Molecular Weight | 339.74 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | N-(2-chloroethyl)-6-fluoro-N-(2,2,2-trifluoroethyl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(c1cc2ccc(F)cc2s1)N(CCCl)CC(F)(F)F |
| InChI | InChI=1S/C13H10ClF4NOS/c14-3-4-19(7-13(16,17)18)12(20)11-5-8-1-2-9(15)6-10(8)21-11/h1-2,5-6H,3-4,7H2 |
| InChIKey | XFLTUISPQFUYFS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.74 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|