C13H14FNOS — CID 78911895
N,N-diethyl-6-fluoro-1-benzothiophene-2-carboxamide (PubChem CID 78911895) has the molecular formula C13H14FNOS and a molecular weight of 251.33 g/mol. Its IUPAC name is N,N-diethyl-6-fluoro-1-benzothiophene-2-carboxamide.
| Compound Name | N,N-diethyl-6-fluoro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 78911895 |
| Molecular Formula | C13H14FNOS |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | N,N-diethyl-6-fluoro-1-benzothiophene-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc2ccc(F)cc2s1 |
| InChI | InChI=1S/C13H14FNOS/c1-3-15(4-2)13(16)12-7-9-5-6-10(14)8-11(9)17-12/h5-8H,3-4H2,1-2H3 |
| InChIKey | MPVFTOLLKXBIBG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |