C13H12F2N2O2 — CID 110490043
7,8-difluoro-N-(2-hydroxypropyl)quinoline-3-carboxamide (PubChem CID 110490043) has the molecular formula C13H12F2N2O2 and a molecular weight of 266.25 g/mol. Its IUPAC name is 7,8-difluoro-N-(2-hydroxypropyl)quinoline-3-carboxamide.
| Compound Name | 7,8-difluoro-N-(2-hydroxypropyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 110490043 |
| Molecular Formula | C13H12F2N2O2 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 7,8-difluoro-N-(2-hydroxypropyl)quinoline-3-carboxamide |
| SMILES | CC(O)CNC(=O)c1cnc2c(F)c(F)ccc2c1 |
| InChI | InChI=1S/C13H12F2N2O2/c1-7(18)5-17-13(19)9-4-8-2-3-10(14)11(15)12(8)16-6-9/h2-4,6-7,18H,5H2,1H3,(H,17,19) |
| InChIKey | MZMQKDRUBVDRJF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |