C15H16F2N2O — CID 110490062
N-butyl-7,8-difluoro-N-methylquinoline-3-carboxamide (PubChem CID 110490062) has the molecular formula C15H16F2N2O and a molecular weight of 278.30 g/mol. Its IUPAC name is N-butyl-7,8-difluoro-N-methylquinoline-3-carboxamide.
| Compound Name | N-butyl-7,8-difluoro-N-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 110490062 |
| Molecular Formula | C15H16F2N2O |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-butyl-7,8-difluoro-N-methylquinoline-3-carboxamide |
| SMILES | CCCCN(C)C(=O)c1cnc2c(F)c(F)ccc2c1 |
| InChI | InChI=1S/C15H16F2N2O/c1-3-4-7-19(2)15(20)11-8-10-5-6-12(16)13(17)14(10)18-9-11/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | UPXAEOUSVWMDAM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |