C17H21ClN4O — CID 109263901
N-butyl-2-(5-chloro-2-methylanilino)-N-methylpyrimidine-5-carboxamide (PubChem CID 109263901) has the molecular formula C17H21ClN4O and a molecular weight of 332.84 g/mol. Its IUPAC name is N-butyl-2-(5-chloro-2-methylanilino)-N-methylpyrimidine-5-carboxamide.
| Compound Name | N-butyl-2-(5-chloro-2-methylanilino)-N-methylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109263901 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | N-butyl-2-(5-chloro-2-methylanilino)-N-methylpyrimidine-5-carboxamide |
| SMILES | CCCCN(C)C(=O)c1cnc(Nc2cc(Cl)ccc2C)nc1 |
| InChI | InChI=1S/C17H21ClN4O/c1-4-5-8-22(3)16(23)13-10-19-17(20-11-13)21-15-9-14(18)7-6-12(15)2/h6-7,9-11H,4-5,8H2,1-3H3,(H,19,20,21) |
| InChIKey | ULHGAJMDALORHD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |