C17H20N4O3 — CID 109263949
2-(1,3-benzodioxol-5-ylamino)-N-butyl-N-methylpyrimidine-5-carboxamide (PubChem CID 109263949) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylamino)-N-butyl-N-methylpyrimidine-5-carboxamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylamino)-N-butyl-N-methylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109263949 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)-N-butyl-N-methylpyrimidine-5-carboxamide |
| SMILES | CCCCN(C)C(=O)c1cnc(Nc2ccc3c(c2)OCO3)nc1 |
| InChI | InChI=1S/C17H20N4O3/c1-3-4-7-21(2)16(22)12-9-18-17(19-10-12)20-13-5-6-14-15(8-13)24-11-23-14/h5-6,8-10H,3-4,7,11H2,1-2H3,(H,18,19,20) |
| InChIKey | WFWQANAWRNDFRJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |