C29H35F2N3O4 — CID 57192037
N-[(2S,3S,5R)-5-(ethylcarbamoyl)-3,8-dihydroxy-8-methyl-1-phenylnonan-2-yl]-7,8-difluoroquinoline-3-carboxamide (PubChem CID 57192037) has the molecular formula C29H35F2N3O4 and a molecular weight of 527.61 g/mol. Its IUPAC name is N-[(2S,3S,5R)-5-(ethylcarbamoyl)-3,8-dihydroxy-8-methyl-1-phenylnonan-2-yl]-7,8-difluoroquinoline-3-carboxamide.
| Compound Name | N-[(2S,3S,5R)-5-(ethylcarbamoyl)-3,8-dihydroxy-8-methyl-1-phenylnonan-2-yl]-7,8-difluoroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 57192037 |
| Molecular Formula | C29H35F2N3O4 |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | N-[(2S,3S,5R)-5-(ethylcarbamoyl)-3,8-dihydroxy-8-methyl-1-phenylnonan-2-yl]-7,8-difluoroquinoline-3-carboxamide |
| SMILES | CCNC(=O)[C@H](CCC(C)(C)O)C[C@H](O)[C@H](Cc1ccccc1)NC(=O)c1cnc2c(F)c(F)ccc2c1 |
| InChI | InChI=1S/C29H35F2N3O4/c1-4-32-27(36)20(12-13-29(2,3)38)16-24(35)23(14-18-8-6-5-7-9-18)34-28(37)21-15-19-10-11-22(30)25(31)26(19)33-17-21/h5-11,15,17,20,23-24,35,38H,4,12-14,16H2,1-3H3,(H,32,36)(H,34,37)/t20-,23+,24+/m1/s1 |
| InChIKey | RMISKEDUWQLXAD-QDSKXPNFSA-N |
| XLogP | 3.91 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |