C19H16F2N2O — CID 156852266
8-fluoro-N-[1-(3-fluorophenyl)propan-2-yl]quinoline-3-carboxamide (PubChem CID 156852266) has the molecular formula C19H16F2N2O and a molecular weight of 326.35 g/mol. Its IUPAC name is 8-fluoro-N-[1-(3-fluorophenyl)propan-2-yl]quinoline-3-carboxamide.
| Compound Name | 8-fluoro-N-[1-(3-fluorophenyl)propan-2-yl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 156852266 |
| Molecular Formula | C19H16F2N2O |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 8-fluoro-N-[1-(3-fluorophenyl)propan-2-yl]quinoline-3-carboxamide |
| SMILES | CC(Cc1cccc(F)c1)NC(=O)c1cnc2c(F)cccc2c1 |
| InChI | InChI=1S/C19H16F2N2O/c1-12(8-13-4-2-6-16(20)9-13)23-19(24)15-10-14-5-3-7-17(21)18(14)22-11-15/h2-7,9-12H,8H2,1H3,(H,23,24) |
| InChIKey | QBCUECOVGILFPO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |