C11H8F2N2O — CID 110490026
7,8-difluoro-N-methylquinoline-3-carboxamide (PubChem CID 110490026) has the molecular formula C11H8F2N2O and a molecular weight of 222.19 g/mol. Its IUPAC name is 7,8-difluoro-N-methylquinoline-3-carboxamide.
| Compound Name | 7,8-difluoro-N-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 110490026 |
| Molecular Formula | C11H8F2N2O |
| Molecular Weight | 222.19 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 7,8-difluoro-N-methylquinoline-3-carboxamide |
| SMILES | CNC(=O)c1cnc2c(F)c(F)ccc2c1 |
| InChI | InChI=1S/C11H8F2N2O/c1-14-11(16)7-4-6-2-3-8(12)9(13)10(6)15-5-7/h2-5H,1H3,(H,14,16) |
| InChIKey | SWGNXTLLQAOMPV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |