C16H16F2N2O — CID 166390335
(7,8-difluoroquinolin-3-yl)-(2-methylpiperidin-1-yl)methanone (PubChem CID 166390335) has the molecular formula C16H16F2N2O and a molecular weight of 290.31 g/mol. Its IUPAC name is (7,8-difluoroquinolin-3-yl)-(2-methylpiperidin-1-yl)methanone.
| Compound Name | (7,8-difluoroquinolin-3-yl)-(2-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 166390335 |
| Molecular Formula | C16H16F2N2O |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (7,8-difluoroquinolin-3-yl)-(2-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCCCN1C(=O)c1cnc2c(F)c(F)ccc2c1 |
| InChI | InChI=1S/C16H16F2N2O/c1-10-4-2-3-7-20(10)16(21)12-8-11-5-6-13(17)14(18)15(11)19-9-12/h5-6,8-10H,2-4,7H2,1H3 |
| InChIKey | JDQSUTWVKBMIOH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |