C18H21Cl2N3O — CID 23725274
[6-(4-chloroanilino)-3-pyridinyl]-(2-methylpiperidin-1-yl)methanone;hydrochloride (PubChem CID 23725274) has the molecular formula C18H21Cl2N3O and a molecular weight of 366.29 g/mol. Its IUPAC name is [6-(4-chloroanilino)-3-pyridinyl]-(2-methylpiperidin-1-yl)methanone;hydrochloride.
| Compound Name | [6-(4-chloroanilino)-3-pyridinyl]-(2-methylpiperidin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 23725274 |
| Molecular Formula | C18H21Cl2N3O |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | [6-(4-chloroanilino)-3-pyridinyl]-(2-methylpiperidin-1-yl)methanone;hydrochloride |
| SMILES | CC1CCCCN1C(=O)c1ccc(Nc2ccc(Cl)cc2)nc1.Cl |
| InChI | InChI=1S/C18H20ClN3O.ClH/c1-13-4-2-3-11-22(13)18(23)14-5-10-17(20-12-14)21-16-8-6-15(19)7-9-16;/h5-10,12-13H,2-4,11H2,1H3,(H,20,21);1H |
| InChIKey | OUOQCCKSJDJFKG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |