C19H20F3N3O — CID 109161690
(2-ethylpiperidin-1-yl)-[6-(2,3,4-trifluoroanilino)-3-pyridinyl]methanone (PubChem CID 109161690) has the molecular formula C19H20F3N3O and a molecular weight of 363.38 g/mol. Its IUPAC name is (2-ethylpiperidin-1-yl)-[6-(2,3,4-trifluoroanilino)-3-pyridinyl]methanone.
| Compound Name | (2-ethylpiperidin-1-yl)-[6-(2,3,4-trifluoroanilino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 109161690 |
| Molecular Formula | C19H20F3N3O |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | (2-ethylpiperidin-1-yl)-[6-(2,3,4-trifluoroanilino)-3-pyridinyl]methanone |
| SMILES | CCC1CCCCN1C(=O)c1ccc(Nc2ccc(F)c(F)c2F)nc1 |
| InChI | InChI=1S/C19H20F3N3O/c1-2-13-5-3-4-10-25(13)19(26)12-6-9-16(23-11-12)24-15-8-7-14(20)17(21)18(15)22/h6-9,11,13H,2-5,10H2,1H3,(H,23,24) |
| InChIKey | GFJMZSFIOAJGRQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|