C19H21F3N4O — CID 112847284
(2-ethylpiperidin-1-yl)-[2-methyl-6-(2,3,4-trifluoroanilino)pyrimidin-4-yl]methanone (PubChem CID 112847284) has the molecular formula C19H21F3N4O and a molecular weight of 378.40 g/mol. Its IUPAC name is (2-ethylpiperidin-1-yl)-[2-methyl-6-(2,3,4-trifluoroanilino)pyrimidin-4-yl]methanone.
| Compound Name | (2-ethylpiperidin-1-yl)-[2-methyl-6-(2,3,4-trifluoroanilino)pyrimidin-4-yl]methanone |
|---|---|
| PubChem CID | 112847284 |
| Molecular Formula | C19H21F3N4O |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (2-ethylpiperidin-1-yl)-[2-methyl-6-(2,3,4-trifluoroanilino)pyrimidin-4-yl]methanone |
| SMILES | CCC1CCCCN1C(=O)c1cc(Nc2ccc(F)c(F)c2F)nc(C)n1 |
| InChI | InChI=1S/C19H21F3N4O/c1-3-12-6-4-5-9-26(12)19(27)15-10-16(24-11(2)23-15)25-14-8-7-13(20)17(21)18(14)22/h7-8,10,12H,3-6,9H2,1-2H3,(H,23,24,25) |
| InChIKey | YAORJRJIZKILAB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|