C24H29Cl2N3O3 — CID 22452505
N-(6-amino-5-cyclohexyl-3-hydroxy-6-oxo-1-phenylhexan-2-yl)-5,6-dichloropyridine-3-carboxamide (PubChem CID 22452505) has the molecular formula C24H29Cl2N3O3 and a molecular weight of 478.42 g/mol. Its IUPAC name is N-(6-amino-5-cyclohexyl-3-hydroxy-6-oxo-1-phenylhexan-2-yl)-5,6-dichloropyridine-3-carboxamide.
| Compound Name | N-(6-amino-5-cyclohexyl-3-hydroxy-6-oxo-1-phenylhexan-2-yl)-5,6-dichloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 22452505 |
| Molecular Formula | C24H29Cl2N3O3 |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | N-(6-amino-5-cyclohexyl-3-hydroxy-6-oxo-1-phenylhexan-2-yl)-5,6-dichloropyridine-3-carboxamide |
| SMILES | NC(=O)C(CC(O)C(Cc1ccccc1)NC(=O)c1cnc(Cl)c(Cl)c1)C1CCCCC1 |
| InChI | InChI=1S/C24H29Cl2N3O3/c25-19-12-17(14-28-22(19)26)24(32)29-20(11-15-7-3-1-4-8-15)21(30)13-18(23(27)31)16-9-5-2-6-10-16/h1,3-4,7-8,12,14,16,18,20-21,30H,2,5-6,9-11,13H2,(H2,27,31)(H,29,32) |
| InChIKey | MBYMCMFFOBUYCA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|