C33H29Cl2N2O5P — CID 12042663
N-[(2S)-1-bis(phenylmethoxy)phosphoryl-3-(3,4-dichlorophenyl)-1-hydroxypropan-2-yl]quinoline-3-carboxamide (PubChem CID 12042663) has the molecular formula C33H29Cl2N2O5P and a molecular weight of 635.48 g/mol. Its IUPAC name is N-[(2S)-1-bis(phenylmethoxy)phosphoryl-3-(3,4-dichlorophenyl)-1-hydroxypropan-2-yl]quinoline-3-carboxamide.
| Compound Name | N-[(2S)-1-bis(phenylmethoxy)phosphoryl-3-(3,4-dichlorophenyl)-1-hydroxypropan-2-yl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 12042663 |
| Molecular Formula | C33H29Cl2N2O5P |
| Molecular Weight | 635.48 g/mol |
| Exact Mass | 634.12 |
| IUPAC Name | N-[(2S)-1-bis(phenylmethoxy)phosphoryl-3-(3,4-dichlorophenyl)-1-hydroxypropan-2-yl]quinoline-3-carboxamide |
| SMILES | O=C(N[C@@H](Cc1ccc(Cl)c(Cl)c1)C(O)P(=O)(OCc1ccccc1)OCc1ccccc1)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C33H29Cl2N2O5P/c34-28-16-15-25(17-29(28)35)18-31(37-32(38)27-19-26-13-7-8-14-30(26)36-20-27)33(39)43(40,41-21-23-9-3-1-4-10-23)42-22-24-11-5-2-6-12-24/h1-17,19-20,31,33,39H,18,21-22H2,(H,37,38)/t31-,33?/m0/s1 |
| InChIKey | AWHVUUXJEWHOJM-MOJIJOCKSA-N |
| XLogP | 7.83 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.48 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|