C18H15FN2O — CID 110694769
N-[2-(4-fluorophenyl)ethyl]quinoline-3-carboxamide (PubChem CID 110694769) has the molecular formula C18H15FN2O and a molecular weight of 294.33 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]quinoline-3-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 110694769 |
| Molecular Formula | C18H15FN2O |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]quinoline-3-carboxamide |
| SMILES | O=C(NCCc1ccc(F)cc1)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C18H15FN2O/c19-16-7-5-13(6-8-16)9-10-20-18(22)15-11-14-3-1-2-4-17(14)21-12-15/h1-8,11-12H,9-10H2,(H,20,22) |
| InChIKey | KOVCMOHPVAKFAB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |