C17H15FN4O — CID 68506824
2-amino-N-[2-(4-fluorophenyl)ethyl]quinazoline-4-carboxamide (PubChem CID 68506824) has the molecular formula C17H15FN4O and a molecular weight of 310.33 g/mol. Its IUPAC name is 2-amino-N-[2-(4-fluorophenyl)ethyl]quinazoline-4-carboxamide.
| Compound Name | 2-amino-N-[2-(4-fluorophenyl)ethyl]quinazoline-4-carboxamide |
|---|---|
| PubChem CID | 68506824 |
| Molecular Formula | C17H15FN4O |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-amino-N-[2-(4-fluorophenyl)ethyl]quinazoline-4-carboxamide |
| SMILES | Nc1nc(C(=O)NCCc2ccc(F)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C17H15FN4O/c18-12-7-5-11(6-8-12)9-10-20-16(23)15-13-3-1-2-4-14(13)21-17(19)22-15/h1-8H,9-10H2,(H,20,23)(H2,19,21,22) |
| InChIKey | QYABYNOMVNAOAO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |