C21H21FN2O — CID 27256543
2-(2,4-dimethylquinolin-3-yl)-N-[2-(4-fluorophenyl)ethyl]acetamide (PubChem CID 27256543) has the molecular formula C21H21FN2O and a molecular weight of 336.41 g/mol. Its IUPAC name is 2-(2,4-dimethylquinolin-3-yl)-N-[2-(4-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-(2,4-dimethylquinolin-3-yl)-N-[2-(4-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 27256543 |
| Molecular Formula | C21H21FN2O |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 2-(2,4-dimethylquinolin-3-yl)-N-[2-(4-fluorophenyl)ethyl]acetamide |
| SMILES | Cc1nc2ccccc2c(C)c1CC(=O)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H21FN2O/c1-14-18-5-3-4-6-20(18)24-15(2)19(14)13-21(25)23-12-11-16-7-9-17(22)10-8-16/h3-10H,11-13H2,1-2H3,(H,23,25) |
| InChIKey | FWRXQHKGBFIGCQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |