C22H25N3O3S — CID 55726824
N-[2-(benzylsulfamoyl)ethyl]-2-(2,4-dimethylquinolin-3-yl)acetamide (PubChem CID 55726824) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is N-[2-(benzylsulfamoyl)ethyl]-2-(2,4-dimethylquinolin-3-yl)acetamide.
| Compound Name | N-[2-(benzylsulfamoyl)ethyl]-2-(2,4-dimethylquinolin-3-yl)acetamide |
|---|---|
| PubChem CID | 55726824 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N-[2-(benzylsulfamoyl)ethyl]-2-(2,4-dimethylquinolin-3-yl)acetamide |
| SMILES | Cc1nc2ccccc2c(C)c1CC(=O)NCCS(=O)(=O)NCc1ccccc1 |
| InChI | InChI=1S/C22H25N3O3S/c1-16-19-10-6-7-11-21(19)25-17(2)20(16)14-22(26)23-12-13-29(27,28)24-15-18-8-4-3-5-9-18/h3-11,24H,12-15H2,1-2H3,(H,23,26) |
| InChIKey | KHCCESIPFWIDOR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |