C20H18ClN3O2 — CID 32925933
2-chloro-N'-[2-(2,4-dimethylquinolin-3-yl)acetyl]benzohydrazide (PubChem CID 32925933) has the molecular formula C20H18ClN3O2 and a molecular weight of 367.84 g/mol. Its IUPAC name is 2-chloro-N'-[2-(2,4-dimethylquinolin-3-yl)acetyl]benzohydrazide.
| Compound Name | 2-chloro-N'-[2-(2,4-dimethylquinolin-3-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 32925933 |
| Molecular Formula | C20H18ClN3O2 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-chloro-N'-[2-(2,4-dimethylquinolin-3-yl)acetyl]benzohydrazide |
| SMILES | Cc1nc2ccccc2c(C)c1CC(=O)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C20H18ClN3O2/c1-12-14-7-4-6-10-18(14)22-13(2)16(12)11-19(25)23-24-20(26)15-8-3-5-9-17(15)21/h3-10H,11H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | GGXITVVJWICXGP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|