C19H17IN2O — CID 8886793
2-(2,4-dimethylquinolin-3-yl)-N-(4-iodophenyl)acetamide (PubChem CID 8886793) has the molecular formula C19H17IN2O and a molecular weight of 416.26 g/mol. Its IUPAC name is 2-(2,4-dimethylquinolin-3-yl)-N-(4-iodophenyl)acetamide.
| Compound Name | 2-(2,4-dimethylquinolin-3-yl)-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 8886793 |
| Molecular Formula | C19H17IN2O |
| Molecular Weight | 416.26 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | 2-(2,4-dimethylquinolin-3-yl)-N-(4-iodophenyl)acetamide |
| SMILES | Cc1nc2ccccc2c(C)c1CC(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C19H17IN2O/c1-12-16-5-3-4-6-18(16)21-13(2)17(12)11-19(23)22-15-9-7-14(20)8-10-15/h3-10H,11H2,1-2H3,(H,22,23) |
| InChIKey | ZDKCYCVKBCDOKK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.26 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|