C21H18N2O — CID 39230533
2-(2,4-dimethylquinolin-3-yl)-N-(3-ethynylphenyl)acetamide (PubChem CID 39230533) has the molecular formula C21H18N2O and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-(2,4-dimethylquinolin-3-yl)-N-(3-ethynylphenyl)acetamide.
| Compound Name | 2-(2,4-dimethylquinolin-3-yl)-N-(3-ethynylphenyl)acetamide |
|---|---|
| PubChem CID | 39230533 |
| Molecular Formula | C21H18N2O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2-(2,4-dimethylquinolin-3-yl)-N-(3-ethynylphenyl)acetamide |
| SMILES | C#Cc1cccc(NC(=O)Cc2c(C)nc3ccccc3c2C)c1 |
| InChI | InChI=1S/C21H18N2O/c1-4-16-8-7-9-17(12-16)23-21(24)13-19-14(2)18-10-5-6-11-20(18)22-15(19)3/h1,5-12H,13H2,2-3H3,(H,23,24) |
| InChIKey | OQXHXYOBNFOYGX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|