C9H13N3O6S2 — CID 106334984
6-[2-(methylsulfamoyl)ethylsulfamoyl]pyridine-3-carboxylic acid (PubChem CID 106334984) has the molecular formula C9H13N3O6S2 and a molecular weight of 323.35 g/mol. Its IUPAC name is 6-[2-(methylsulfamoyl)ethylsulfamoyl]pyridine-3-carboxylic acid.
| Compound Name | 6-[2-(methylsulfamoyl)ethylsulfamoyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 106334984 |
| Molecular Formula | C9H13N3O6S2 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 6-[2-(methylsulfamoyl)ethylsulfamoyl]pyridine-3-carboxylic acid |
| SMILES | CNS(=O)(=O)CCNS(=O)(=O)c1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C9H13N3O6S2/c1-10-19(15,16)5-4-12-20(17,18)8-3-2-7(6-11-8)9(13)14/h2-3,6,10,12H,4-5H2,1H3,(H,13,14) |
| InChIKey | KALASGZSYMECDD-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 142.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |