C12H14N2O4S — CID 106209006
6-(hex-5-ynylsulfamoyl)pyridine-3-carboxylic acid (PubChem CID 106209006) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is 6-(hex-5-ynylsulfamoyl)pyridine-3-carboxylic acid.
| Compound Name | 6-(hex-5-ynylsulfamoyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 106209006 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 6-(hex-5-ynylsulfamoyl)pyridine-3-carboxylic acid |
| SMILES | C#CCCCCNS(=O)(=O)c1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C12H14N2O4S/c1-2-3-4-5-8-14-19(17,18)11-7-6-10(9-13-11)12(15)16/h1,6-7,9,14H,3-5,8H2,(H,15,16) |
| InChIKey | MWRMFUIQBUJSDI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|