C12H18N2O6S — CID 79538530
6-(2,2-diethoxyethylsulfamoyl)pyridine-3-carboxylic acid (PubChem CID 79538530) has the molecular formula C12H18N2O6S and a molecular weight of 318.35 g/mol. Its IUPAC name is 6-(2,2-diethoxyethylsulfamoyl)pyridine-3-carboxylic acid.
| Compound Name | 6-(2,2-diethoxyethylsulfamoyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 79538530 |
| Molecular Formula | C12H18N2O6S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 6-(2,2-diethoxyethylsulfamoyl)pyridine-3-carboxylic acid |
| SMILES | CCOC(CNS(=O)(=O)c1ccc(C(=O)O)cn1)OCC |
| InChI | InChI=1S/C12H18N2O6S/c1-3-19-11(20-4-2)8-14-21(17,18)10-6-5-9(7-13-10)12(15)16/h5-7,11,14H,3-4,8H2,1-2H3,(H,15,16) |
| InChIKey | UBYIQMFEVLTWNL-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|