C12H18N2O5S — CID 106290912
6-[(2-hydroxy-2-methylpentyl)sulfamoyl]pyridine-3-carboxylic acid (PubChem CID 106290912) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is 6-[(2-hydroxy-2-methylpentyl)sulfamoyl]pyridine-3-carboxylic acid.
| Compound Name | 6-[(2-hydroxy-2-methylpentyl)sulfamoyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 106290912 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 6-[(2-hydroxy-2-methylpentyl)sulfamoyl]pyridine-3-carboxylic acid |
| SMILES | CCCC(C)(O)CNS(=O)(=O)c1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C12H18N2O5S/c1-3-6-12(2,17)8-14-20(18,19)10-5-4-9(7-13-10)11(15)16/h4-5,7,14,17H,3,6,8H2,1-2H3,(H,15,16) |
| InChIKey | NXJPKGWPRAUBTK-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |