C10H17N3O5S — CID 114169194
5-[(2-hydroxy-2-methylpentyl)sulfamoyl]-1H-pyrazole-4-carboxylic acid (PubChem CID 114169194) has the molecular formula C10H17N3O5S and a molecular weight of 291.33 g/mol. Its IUPAC name is 5-[(2-hydroxy-2-methylpentyl)sulfamoyl]-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-[(2-hydroxy-2-methylpentyl)sulfamoyl]-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 114169194 |
| Molecular Formula | C10H17N3O5S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 5-[(2-hydroxy-2-methylpentyl)sulfamoyl]-1H-pyrazole-4-carboxylic acid |
| SMILES | CCCC(C)(O)CNS(=O)(=O)c1[nH]ncc1C(=O)O |
| InChI | InChI=1S/C10H17N3O5S/c1-3-4-10(2,16)6-12-19(17,18)8-7(9(14)15)5-11-13-8/h5,12,16H,3-4,6H2,1-2H3,(H,11,13)(H,14,15) |
| InChIKey | ZJGRQOCPNIBJKD-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 132.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |