C14H24N3O4S+ — CID 7618004
2-[2-[(3-methoxybenzoyl)amino]ethylsulfonylamino]ethyl-dimethylazanium (PubChem CID 7618004) has the molecular formula C14H24N3O4S+ and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-[2-[(3-methoxybenzoyl)amino]ethylsulfonylamino]ethyl-dimethylazanium.
| Compound Name | 2-[2-[(3-methoxybenzoyl)amino]ethylsulfonylamino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7618004 |
| Molecular Formula | C14H24N3O4S+ |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 2-[2-[(3-methoxybenzoyl)amino]ethylsulfonylamino]ethyl-dimethylazanium |
| SMILES | COc1cccc(C(=O)NCCS(=O)(=O)NCC[NH+](C)C)c1 |
| InChI | InChI=1S/C14H23N3O4S/c1-17(2)9-7-16-22(19,20)10-8-15-14(18)12-5-4-6-13(11-12)21-3/h4-6,11,16H,7-10H2,1-3H3,(H,15,18)/p+1 |
| InChIKey | VZIDTYQFWHNZJM-UHFFFAOYSA-O |
| XLogP | -1.51 |
| TPSA | 88.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |