C17H24N2O7S — CID 7618105
N-[2-[[(2R,5R)-2,5-dimethoxy-2H-furan-5-yl]methylsulfamoyl]ethyl]-3-methoxybenzamide (PubChem CID 7618105) has the molecular formula C17H24N2O7S and a molecular weight of 400.45 g/mol. Its IUPAC name is N-[2-[[(2R,5R)-2,5-dimethoxy-2H-furan-5-yl]methylsulfamoyl]ethyl]-3-methoxybenzamide.
| Compound Name | N-[2-[[(2R,5R)-2,5-dimethoxy-2H-furan-5-yl]methylsulfamoyl]ethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 7618105 |
| Molecular Formula | C17H24N2O7S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | N-[2-[[(2R,5R)-2,5-dimethoxy-2H-furan-5-yl]methylsulfamoyl]ethyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NCCS(=O)(=O)NC[C@@]2(OC)C=C[C@H](OC)O2)c1 |
| InChI | InChI=1S/C17H24N2O7S/c1-23-14-6-4-5-13(11-14)16(20)18-9-10-27(21,22)19-12-17(25-3)8-7-15(24-2)26-17/h4-8,11,15,19H,9-10,12H2,1-3H3,(H,18,20)/t15-,17-/m1/s1 |
| InChIKey | JRWIPQVIQJFATE-NVXWUHKLSA-N |
| XLogP | 0.25 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|