C15H24N3O4S+ — CID 7601092
3-methoxy-N-[2-(4-methylpiperazin-4-ium-1-yl)sulfonylethyl]benzamide (PubChem CID 7601092) has the molecular formula C15H24N3O4S+ and a molecular weight of 342.44 g/mol. Its IUPAC name is 3-methoxy-N-[2-(4-methylpiperazin-4-ium-1-yl)sulfonylethyl]benzamide.
| Compound Name | 3-methoxy-N-[2-(4-methylpiperazin-4-ium-1-yl)sulfonylethyl]benzamide |
|---|---|
| PubChem CID | 7601092 |
| Molecular Formula | C15H24N3O4S+ |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 3-methoxy-N-[2-(4-methylpiperazin-4-ium-1-yl)sulfonylethyl]benzamide |
| SMILES | COc1cccc(C(=O)NCCS(=O)(=O)N2CC[NH+](C)CC2)c1 |
| InChI | InChI=1S/C15H23N3O4S/c1-17-7-9-18(10-8-17)23(20,21)11-6-16-15(19)13-4-3-5-14(12-13)22-2/h3-5,12H,6-11H2,1-2H3,(H,16,19)/p+1 |
| InChIKey | ISAVIUGLCUAIHG-UHFFFAOYSA-O |
| XLogP | -1.41 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |