C13H17FO2 — CID 146006763
1-(3-fluoro-5-methoxyphenyl)-3,3-dimethylbutan-1-one (PubChem CID 146006763) has the molecular formula C13H17FO2 and a molecular weight of 224.28 g/mol. Its IUPAC name is 1-(3-fluoro-5-methoxyphenyl)-3,3-dimethylbutan-1-one.
| Compound Name | 1-(3-fluoro-5-methoxyphenyl)-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 146006763 |
| Molecular Formula | C13H17FO2 |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1-(3-fluoro-5-methoxyphenyl)-3,3-dimethylbutan-1-one |
| SMILES | COc1cc(F)cc(C(=O)CC(C)(C)C)c1 |
| InChI | InChI=1S/C13H17FO2/c1-13(2,3)8-12(15)9-5-10(14)7-11(6-9)16-4/h5-7H,8H2,1-4H3 |
| InChIKey | UOOWPNUJLKNQEH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |