C12H16FNO2 — CID 168736985
2-(3-fluoro-5-methoxyphenyl)-N,2-dimethylpropanamide (PubChem CID 168736985) has the molecular formula C12H16FNO2 and a molecular weight of 225.26 g/mol. Its IUPAC name is 2-(3-fluoro-5-methoxyphenyl)-N,2-dimethylpropanamide.
| Compound Name | 2-(3-fluoro-5-methoxyphenyl)-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 168736985 |
| Molecular Formula | C12H16FNO2 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-(3-fluoro-5-methoxyphenyl)-N,2-dimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)c1cc(F)cc(OC)c1 |
| InChI | InChI=1S/C12H16FNO2/c1-12(2,11(15)14-3)8-5-9(13)7-10(6-8)16-4/h5-7H,1-4H3,(H,14,15) |
| InChIKey | CPKSITNOIKWMPC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |