C9H10FNO2S — CID 130500039
N-(3-fluoro-5-methoxyphenyl)-2-sulfanylacetamide (PubChem CID 130500039) has the molecular formula C9H10FNO2S and a molecular weight of 215.25 g/mol. Its IUPAC name is N-(3-fluoro-5-methoxyphenyl)-2-sulfanylacetamide.
| Compound Name | N-(3-fluoro-5-methoxyphenyl)-2-sulfanylacetamide |
|---|---|
| PubChem CID | 130500039 |
| Molecular Formula | C9H10FNO2S |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | N-(3-fluoro-5-methoxyphenyl)-2-sulfanylacetamide |
| SMILES | COc1cc(F)cc(NC(=O)CS)c1 |
| InChI | InChI=1S/C9H10FNO2S/c1-13-8-3-6(10)2-7(4-8)11-9(12)5-14/h2-4,14H,5H2,1H3,(H,11,12) |
| InChIKey | ASVDLFZUYCYSPB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|