C28H34O5 — CID 70361251
(2R)-2-[6-[6-(2,3-dihydroxy-4-propan-2-ylphenyl)hexoxy]naphthalen-2-yl]propanoic acid (PubChem CID 70361251) has the molecular formula C28H34O5 and a molecular weight of 450.58 g/mol. Its IUPAC name is (2R)-2-[6-[6-(2,3-dihydroxy-4-propan-2-ylphenyl)hexoxy]naphthalen-2-yl]propanoic acid.
| Compound Name | (2R)-2-[6-[6-(2,3-dihydroxy-4-propan-2-ylphenyl)hexoxy]naphthalen-2-yl]propanoic acid |
|---|---|
| PubChem CID | 70361251 |
| Molecular Formula | C28H34O5 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | (2R)-2-[6-[6-(2,3-dihydroxy-4-propan-2-ylphenyl)hexoxy]naphthalen-2-yl]propanoic acid |
| SMILES | CC(C)c1ccc(CCCCCCOc2ccc3cc([C@@H](C)C(=O)O)ccc3c2)c(O)c1O |
| InChI | InChI=1S/C28H34O5/c1-18(2)25-14-12-20(26(29)27(25)30)8-6-4-5-7-15-33-24-13-11-22-16-21(19(3)28(31)32)9-10-23(22)17-24/h9-14,16-19,29-30H,4-8,15H2,1-3H3,(H,31,32)/t19-/m1/s1 |
| InChIKey | DKIXMURIFHYCRK-LJQANCHMSA-N |
| XLogP | 6.74 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|