C27H32O5 — CID 18639931
(2S)-2-[6-[6-(3,4-dihydroxy-2,5-dimethylphenyl)hexoxy]naphthalen-2-yl]propanoic acid (PubChem CID 18639931) has the molecular formula C27H32O5 and a molecular weight of 436.55 g/mol. Its IUPAC name is (2S)-2-[6-[6-(3,4-dihydroxy-2,5-dimethylphenyl)hexoxy]naphthalen-2-yl]propanoic acid.
| Compound Name | (2S)-2-[6-[6-(3,4-dihydroxy-2,5-dimethylphenyl)hexoxy]naphthalen-2-yl]propanoic acid |
|---|---|
| PubChem CID | 18639931 |
| Molecular Formula | C27H32O5 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | (2S)-2-[6-[6-(3,4-dihydroxy-2,5-dimethylphenyl)hexoxy]naphthalen-2-yl]propanoic acid |
| SMILES | Cc1cc(CCCCCCOc2ccc3cc([C@H](C)C(=O)O)ccc3c2)c(C)c(O)c1O |
| InChI | InChI=1S/C27H32O5/c1-17-14-20(18(2)26(29)25(17)28)8-6-4-5-7-13-32-24-12-11-22-15-21(19(3)27(30)31)9-10-23(22)16-24/h9-12,14-16,19,28-29H,4-8,13H2,1-3H3,(H,30,31)/t19-/m0/s1 |
| InChIKey | PZWPLHWWQCVECP-IBGZPJMESA-N |
| XLogP | 6.24 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|