C29H41NO4 — CID 136748050
[(2S)-2-methylbutyl] 4-[(4-decoxy-2-hydroxyphenyl)methylideneamino]benzoate (PubChem CID 136748050) has the molecular formula C29H41NO4 and a molecular weight of 467.65 g/mol. Its IUPAC name is [(2S)-2-methylbutyl] 4-[(4-decoxy-2-hydroxyphenyl)methylideneamino]benzoate.
| Compound Name | [(2S)-2-methylbutyl] 4-[(4-decoxy-2-hydroxyphenyl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 136748050 |
| Molecular Formula | C29H41NO4 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.30 |
| IUPAC Name | [(2S)-2-methylbutyl] 4-[(4-decoxy-2-hydroxyphenyl)methylideneamino]benzoate |
| SMILES | CCCCCCCCCCOc1ccc(/C=N/c2ccc(C(=O)OC[C@@H](C)CC)cc2)c(O)c1 |
| InChI | InChI=1S/C29H41NO4/c1-4-6-7-8-9-10-11-12-19-33-27-18-15-25(28(31)20-27)21-30-26-16-13-24(14-17-26)29(32)34-22-23(3)5-2/h13-18,20-21,23,31H,4-12,19,22H2,1-3H3/b30-21+/t23-/m0/s1 |
| InChIKey | FFKHLFDVZSDTGX-DPBBQRGUSA-N |
| XLogP | 7.87 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|