About [4-[2-[2-[(2S)-2-methylbutoxy]-4-pyridinyl]ethynyl]phenyl] 4-nonoxybenzoate
[4-[2-[2-[(2S)-2-methylbutoxy]-4-pyridinyl]ethynyl]phenyl] 4-nonoxybenzoate (PubChem CID 102210952) has the molecular formula C34H41NO4
and a molecular weight of 527.71 g/mol. Its IUPAC name is [4-[2-[2-[(2S)-2-methylbutoxy]-4-pyridinyl]ethynyl]phenyl] 4-nonoxybenzoate.
Molecular Properties
| Compound Name | [4-[2-[2-[(2S)-2-methylbutoxy]-4-pyridinyl]ethynyl]phenyl] 4-nonoxybenzoate |
| PubChem CID | 102210952 |
| Molecular Formula | C34H41NO4 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.30 |
| IUPAC Name | [4-[2-[2-[(2S)-2-methylbutoxy]-4-pyridinyl]ethynyl]phenyl] 4-nonoxybenzoate |
| SMILES | CCCCCCCCCOc1ccc(C(=O)Oc2ccc(C#Cc3ccnc(OC[C@@H](C)CC)c3)cc2)cc1 |
| InChI | InChI=1S/C34H41NO4/c1-4-6-7-8-9-10-11-24-37-31-20-16-30(17-21-31)34(36)39-32-18-14-28(15-19-32)12-13-29-22-23-35-33(25-29)38-26-27(3)5-2/h14-23,25,27H,4-11,24,26H2,1-3H3/t27-/m0/s1 |
| InChIKey | FMUIOMYBKYFPOS-MHZLTWQESA-N |
| XLogP | 8.25 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-[2-[(2S)-2-methylbutoxy]-4-pyridinyl]ethynyl]phenyl] 4-nonoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-[2-[(2S)-2-methylbutoxy]-4-pyridinyl]ethynyl]phenyl] 4-nonoxybenzoate?
The IUPAC name of [4-[2-[2-[(2S)-2-methylbutoxy]-4-pyridinyl]ethynyl]phenyl] 4-nonoxybenzoate (CID 102210952) is [4-[2-[2-[(2S)-2-methylbutoxy]-4-pyridinyl]ethynyl]phenyl] 4-nonoxybenzoate.
What is the SMILES notation for [4-[2-[2-[(2S)-2-methylbutoxy]-4-pyridinyl]ethynyl]phenyl] 4-nonoxybenzoate?
The canonical SMILES for [4-[2-[2-[(2S)-2-methylbutoxy]-4-pyridinyl]ethynyl]phenyl] 4-nonoxybenzoate is CCCCCCCCCOc1ccc(C(=O)Oc2ccc(C#Cc3ccnc(OC[C@@H](C)CC)c3)cc2)cc1.
What is the InChIKey of [4-[2-[2-[(2S)-2-methylbutoxy]-4-pyridinyl]ethynyl]phenyl] 4-nonoxybenzoate?
The InChIKey is FMUIOMYBKYFPOS-MHZLTWQESA-N. The full InChI is InChI=1S/C34H41NO4/c1-4-6-7-8-9-10-11-24-37-31-20-16-30(17-21-31)34(36)39-32-18-14-28(15-19-32)12-13-29-22-23-35-33(25-29)38-26-27(3)5-2/h14-23,25,27H,4-11,24,26H2,1-3H3/t27-/m0/s1.
What are the key properties of [4-[2-[2-[(2S)-2-methylbutoxy]-4-pyridinyl]ethynyl]phenyl] 4-nonoxybenzoate?
[4-[2-[2-[(2S)-2-methylbutoxy]-4-pyridinyl]ethynyl]phenyl] 4-nonoxybenzoate has a molecular weight of 527.71 g/mol, XLogP of 8.25, 15 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-[2-[(2S)-2-methylbutoxy]-4-pyridinyl]ethynyl]phenyl] 4-nonoxybenzoate is sourced from PubChem (CID 102210952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).