C23H24N2O2S — CID 54564112
[4-[4-(5-propyl-1,3,4-thiadiazol-2-yl)phenyl]phenyl] hex-2-enoate (PubChem CID 54564112) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is [4-[4-(5-propyl-1,3,4-thiadiazol-2-yl)phenyl]phenyl] hex-2-enoate.
| Compound Name | [4-[4-(5-propyl-1,3,4-thiadiazol-2-yl)phenyl]phenyl] hex-2-enoate |
|---|---|
| PubChem CID | 54564112 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | [4-[4-(5-propyl-1,3,4-thiadiazol-2-yl)phenyl]phenyl] hex-2-enoate |
| SMILES | CCCC=CC(=O)Oc1ccc(-c2ccc(-c3nnc(CCC)s3)cc2)cc1 |
| InChI | InChI=1S/C23H24N2O2S/c1-3-5-6-8-22(26)27-20-15-13-18(14-16-20)17-9-11-19(12-10-17)23-25-24-21(28-23)7-4-2/h6,8-16H,3-5,7H2,1-2H3 |
| InChIKey | ZSPYJLVMTNMHMS-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|