About [4-[4-(5-propyl-1,3,4-thiadiazol-2-yl)phenyl]phenyl] (E)-hex-4-enoate
[4-[4-(5-propyl-1,3,4-thiadiazol-2-yl)phenyl]phenyl] (E)-hex-4-enoate (PubChem CID 23432121) has the molecular formula C23H24N2O2S
and a molecular weight of 392.52 g/mol. Its IUPAC name is [4-[4-(5-propyl-1,3,4-thiadiazol-2-yl)phenyl]phenyl] (E)-hex-4-enoate.
Molecular Properties
| Compound Name | [4-[4-(5-propyl-1,3,4-thiadiazol-2-yl)phenyl]phenyl] (E)-hex-4-enoate |
| PubChem CID | 23432121 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | [4-[4-(5-propyl-1,3,4-thiadiazol-2-yl)phenyl]phenyl] (E)-hex-4-enoate |
| SMILES | C/C=C/CCC(=O)Oc1ccc(-c2ccc(-c3nnc(CCC)s3)cc2)cc1 |
| InChI | InChI=1S/C23H24N2O2S/c1-3-5-6-8-22(26)27-20-15-13-18(14-16-20)17-9-11-19(12-10-17)23-25-24-21(28-23)7-4-2/h3,5,9-16H,4,6-8H2,1-2H3/b5-3+ |
| InChIKey | KGWUWLHPYZTALR-HWKANZROSA-N |
| XLogP | 6.09 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-(5-propyl-1,3,4-thiadiazol-2-yl)phenyl]phenyl] (E)-hex-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(5-propyl-1,3,4-thiadiazol-2-yl)phenyl]phenyl] (E)-hex-4-enoate?
The IUPAC name of [4-[4-(5-propyl-1,3,4-thiadiazol-2-yl)phenyl]phenyl] (E)-hex-4-enoate (CID 23432121) is [4-[4-(5-propyl-1,3,4-thiadiazol-2-yl)phenyl]phenyl] (E)-hex-4-enoate.
What is the SMILES notation for [4-[4-(5-propyl-1,3,4-thiadiazol-2-yl)phenyl]phenyl] (E)-hex-4-enoate?
The canonical SMILES for [4-[4-(5-propyl-1,3,4-thiadiazol-2-yl)phenyl]phenyl] (E)-hex-4-enoate is C/C=C/CCC(=O)Oc1ccc(-c2ccc(-c3nnc(CCC)s3)cc2)cc1.
What is the InChIKey of [4-[4-(5-propyl-1,3,4-thiadiazol-2-yl)phenyl]phenyl] (E)-hex-4-enoate?
The InChIKey is KGWUWLHPYZTALR-HWKANZROSA-N. The full InChI is InChI=1S/C23H24N2O2S/c1-3-5-6-8-22(26)27-20-15-13-18(14-16-20)17-9-11-19(12-10-17)23-25-24-21(28-23)7-4-2/h3,5,9-16H,4,6-8H2,1-2H3/b5-3+.
What are the key properties of [4-[4-(5-propyl-1,3,4-thiadiazol-2-yl)phenyl]phenyl] (E)-hex-4-enoate?
[4-[4-(5-propyl-1,3,4-thiadiazol-2-yl)phenyl]phenyl] (E)-hex-4-enoate has a molecular weight of 392.52 g/mol, XLogP of 6.09, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(5-propyl-1,3,4-thiadiazol-2-yl)phenyl]phenyl] (E)-hex-4-enoate is sourced from PubChem (CID 23432121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).