C17H20N2O2S — CID 23432266
[4-(5-propyl-1,3,4-thiadiazol-2-yl)phenyl] (E)-hex-4-enoate (PubChem CID 23432266) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is [4-(5-propyl-1,3,4-thiadiazol-2-yl)phenyl] (E)-hex-4-enoate.
| Compound Name | [4-(5-propyl-1,3,4-thiadiazol-2-yl)phenyl] (E)-hex-4-enoate |
|---|---|
| PubChem CID | 23432266 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | [4-(5-propyl-1,3,4-thiadiazol-2-yl)phenyl] (E)-hex-4-enoate |
| SMILES | C/C=C/CCC(=O)Oc1ccc(-c2nnc(CCC)s2)cc1 |
| InChI | InChI=1S/C17H20N2O2S/c1-3-5-6-8-16(20)21-14-11-9-13(10-12-14)17-19-18-15(22-17)7-4-2/h3,5,9-12H,4,6-8H2,1-2H3/b5-3+ |
| InChIKey | HORCJFXGBONVFM-HWKANZROSA-N |
| XLogP | 4.42 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|