C17H29BO2S — CID 174712167
2-(4-hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborinane (PubChem CID 174712167) has the molecular formula C17H29BO2S and a molecular weight of 308.30 g/mol. Its IUPAC name is 2-(4-hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborinane.
| Compound Name | 2-(4-hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 174712167 |
| Molecular Formula | C17H29BO2S |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 2-(4-hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborinane |
| SMILES | CCCCCCc1csc(B2OCC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C17H29BO2S/c1-6-7-8-9-10-14-11-15(21-12-14)18-19-13-16(2,3)17(4,5)20-18/h11-12H,6-10,13H2,1-5H3 |
| InChIKey | BGLNZKHQTUQTSK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|