C16H15F2NO2 — CID 171934660
(3,3-difluoropiperidin-1-yl)-(6-hydroxynaphthalen-1-yl)methanone (PubChem CID 171934660) has the molecular formula C16H15F2NO2 and a molecular weight of 291.30 g/mol. Its IUPAC name is (3,3-difluoropiperidin-1-yl)-(6-hydroxynaphthalen-1-yl)methanone.
| Compound Name | (3,3-difluoropiperidin-1-yl)-(6-hydroxynaphthalen-1-yl)methanone |
|---|---|
| PubChem CID | 171934660 |
| Molecular Formula | C16H15F2NO2 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (3,3-difluoropiperidin-1-yl)-(6-hydroxynaphthalen-1-yl)methanone |
| SMILES | O=C(c1cccc2cc(O)ccc12)N1CCCC(F)(F)C1 |
| InChI | InChI=1S/C16H15F2NO2/c17-16(18)7-2-8-19(10-16)15(21)14-4-1-3-11-9-12(20)5-6-13(11)14/h1,3-6,9,20H,2,7-8,10H2 |
| InChIKey | ASILNBBGNLUYAU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |