About CID 175633312
CID 175633312 (PubChem CID 175633312) has the molecular formula C13H14BF3N2O
and a molecular weight of 282.07 g/mol.
Molecular Properties
| Compound Name | CID 175633312 |
| PubChem CID | 175633312 |
| Molecular Formula | C13H14BF3N2O |
| Molecular Weight | 282.07 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | — |
| SMILES | [B]c1cc(NC)c(F)c(C(=O)N2CCCC(F)(F)C2)c1 |
| InChI | InChI=1S/C13H14BF3N2O/c1-18-10-6-8(14)5-9(11(10)15)12(20)19-4-2-3-13(16,17)7-19/h5-6,18H,2-4,7H2,1H3 |
| InChIKey | OZFWNZVXDQFZDU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.07 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175633312 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175633312?
The IUPAC name of CID 175633312 (CID 175633312) is not available.
What is the SMILES notation for CID 175633312?
The canonical SMILES for CID 175633312 is [B]c1cc(NC)c(F)c(C(=O)N2CCCC(F)(F)C2)c1.
What is the InChIKey of CID 175633312?
The InChIKey is OZFWNZVXDQFZDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BF3N2O/c1-18-10-6-8(14)5-9(11(10)15)12(20)19-4-2-3-13(16,17)7-19/h5-6,18H,2-4,7H2,1H3.
What are the key properties of CID 175633312?
CID 175633312 has a molecular weight of 282.07 g/mol, XLogP of 1.53, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175633312 is sourced from PubChem (CID 175633312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).