C21H26BNO4 — CID 171396841
N-(oxolan-3-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxamide (PubChem CID 171396841) has the molecular formula C21H26BNO4 and a molecular weight of 367.25 g/mol. Its IUPAC name is N-(oxolan-3-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxamide.
| Compound Name | N-(oxolan-3-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 171396841 |
| Molecular Formula | C21H26BNO4 |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | N-(oxolan-3-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2-carboxamide |
| SMILES | CC1(C)OB(c2cccc3cc(C(=O)NC4CCOC4)ccc23)OC1(C)C |
| InChI | InChI=1S/C21H26BNO4/c1-20(2)21(3,4)27-22(26-20)18-7-5-6-14-12-15(8-9-17(14)18)19(24)23-16-10-11-25-13-16/h5-9,12,16H,10-11,13H2,1-4H3,(H,23,24) |
| InChIKey | GNNSWMPAZKBAKH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|