C9H9F2NOS — CID 122269158
(3,3-difluoropyrrolidin-1-yl)-thiophen-2-ylmethanone (PubChem CID 122269158) has the molecular formula C9H9F2NOS and a molecular weight of 217.24 g/mol. Its IUPAC name is (3,3-difluoropyrrolidin-1-yl)-thiophen-2-ylmethanone.
| Compound Name | (3,3-difluoropyrrolidin-1-yl)-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 122269158 |
| Molecular Formula | C9H9F2NOS |
| Molecular Weight | 217.24 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | (3,3-difluoropyrrolidin-1-yl)-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C9H9F2NOS/c10-9(11)3-4-12(6-9)8(13)7-2-1-5-14-7/h1-2,5H,3-4,6H2 |
| InChIKey | MRLXCJFYYKBOGQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |